C17H22N4O3S — CID 32697229
N-(3-cyanothiophen-2-yl)-3-[4-[(2S)-oxolane-2-carbonyl]piperazin-1-yl]propanamide (PubChem CID 32697229) has the molecular formula C17H22N4O3S and a molecular weight of 362.46 g/mol. Its IUPAC name is N-(3-cyanothiophen-2-yl)-3-[4-[(2S)-oxolane-2-carbonyl]piperazin-1-yl]propanamide.
| Compound Name | N-(3-cyanothiophen-2-yl)-3-[4-[(2S)-oxolane-2-carbonyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 32697229 |
| Molecular Formula | C17H22N4O3S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | N-(3-cyanothiophen-2-yl)-3-[4-[(2S)-oxolane-2-carbonyl]piperazin-1-yl]propanamide |
| SMILES | N#Cc1ccsc1NC(=O)CCN1CCN(C(=O)[C@@H]2CCCO2)CC1 |
| InChI | InChI=1S/C17H22N4O3S/c18-12-13-4-11-25-16(13)19-15(22)3-5-20-6-8-21(9-7-20)17(23)14-2-1-10-24-14/h4,11,14H,1-3,5-10H2,(H,19,22)/t14-/m0/s1 |
| InChIKey | HJOPQAVPDBQCHD-AWEZNQCLSA-N |
| XLogP | 1.27 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |