About N-(5H-chromeno[4,3-d]pyrimidin-2-yl)-4-methylbenzamide
N-(5H-chromeno[4,3-d]pyrimidin-2-yl)-4-methylbenzamide (PubChem CID 3270154) has the molecular formula C19H15N3O2
and a molecular weight of 317.35 g/mol. Its IUPAC name is N-(5H-chromeno[4,3-d]pyrimidin-2-yl)-4-methylbenzamide.
Molecular Properties
| Compound Name | N-(5H-chromeno[4,3-d]pyrimidin-2-yl)-4-methylbenzamide |
| PubChem CID | 3270154 |
| Molecular Formula | C19H15N3O2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | N-(5H-chromeno[4,3-d]pyrimidin-2-yl)-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ncc3c(n2)-c2ccccc2OC3)cc1 |
| InChI | InChI=1S/C19H15N3O2/c1-12-6-8-13(9-7-12)18(23)22-19-20-10-14-11-24-16-5-3-2-4-15(16)17(14)21-19/h2-10H,11H2,1H3,(H,20,21,22,23) |
| InChIKey | XEHUIPWFZREHDF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(5H-chromeno[4,3-d]pyrimidin-2-yl)-4-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5H-chromeno[4,3-d]pyrimidin-2-yl)-4-methylbenzamide?
The IUPAC name of N-(5H-chromeno[4,3-d]pyrimidin-2-yl)-4-methylbenzamide (CID 3270154) is N-(5H-chromeno[4,3-d]pyrimidin-2-yl)-4-methylbenzamide.
What is the SMILES notation for N-(5H-chromeno[4,3-d]pyrimidin-2-yl)-4-methylbenzamide?
The canonical SMILES for N-(5H-chromeno[4,3-d]pyrimidin-2-yl)-4-methylbenzamide is Cc1ccc(C(=O)Nc2ncc3c(n2)-c2ccccc2OC3)cc1.
What is the InChIKey of N-(5H-chromeno[4,3-d]pyrimidin-2-yl)-4-methylbenzamide?
The InChIKey is XEHUIPWFZREHDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N3O2/c1-12-6-8-13(9-7-12)18(23)22-19-20-10-14-11-24-16-5-3-2-4-15(16)17(14)21-19/h2-10H,11H2,1H3,(H,20,21,22,23).
What are the key properties of N-(5H-chromeno[4,3-d]pyrimidin-2-yl)-4-methylbenzamide?
N-(5H-chromeno[4,3-d]pyrimidin-2-yl)-4-methylbenzamide has a molecular weight of 317.35 g/mol, XLogP of 3.60, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5H-chromeno[4,3-d]pyrimidin-2-yl)-4-methylbenzamide is sourced from PubChem (CID 3270154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).