C10H10N6O3 — CID 32702957
6-[(3-nitrophenoxy)methyl]-1,3,5-triazine-2,4-diamine (PubChem CID 32702957) has the molecular formula C10H10N6O3 and a molecular weight of 262.23 g/mol. Its IUPAC name is 6-[(3-nitrophenoxy)methyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[(3-nitrophenoxy)methyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 32702957 |
| Molecular Formula | C10H10N6O3 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 6-[(3-nitrophenoxy)methyl]-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(COc2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C10H10N6O3/c11-9-13-8(14-10(12)15-9)5-19-7-3-1-2-6(4-7)16(17)18/h1-4H,5H2,(H4,11,12,13,14,15) |
| InChIKey | KWQUIWRMKDJDSA-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 143.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|