C36H40FN3O3 — CID 3270686
[4-[1-(2-fluorophenyl)-5-(3-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]-(4-hexylphenyl)methanone (PubChem CID 3270686) has the molecular formula C36H40FN3O3 and a molecular weight of 581.73 g/mol. Its IUPAC name is [4-[1-(2-fluorophenyl)-5-(3-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]-(4-hexylphenyl)methanone.
| Compound Name | [4-[1-(2-fluorophenyl)-5-(3-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]-(4-hexylphenyl)methanone |
|---|---|
| PubChem CID | 3270686 |
| Molecular Formula | C36H40FN3O3 |
| Molecular Weight | 581.73 g/mol |
| Exact Mass | 581.31 |
| IUPAC Name | [4-[1-(2-fluorophenyl)-5-(3-methoxyphenyl)-2-methylpyrrole-3-carbonyl]piperazin-1-yl]-(4-hexylphenyl)methanone |
| SMILES | CCCCCCc1ccc(C(=O)N2CCN(C(=O)c3cc(-c4cccc(OC)c4)n(-c4ccccc4F)c3C)CC2)cc1 |
| InChI | InChI=1S/C36H40FN3O3/c1-4-5-6-7-11-27-16-18-28(19-17-27)35(41)38-20-22-39(23-21-38)36(42)31-25-34(29-12-10-13-30(24-29)43-3)40(26(31)2)33-15-9-8-14-32(33)37/h8-10,12-19,24-25H,4-7,11,20-23H2,1-3H3 |
| InChIKey | BVCCGKSVNPFFAO-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.73 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|