C20H15N5O5S — CID 3271353
N'-(2-cyanoethyl)-N'-(1,1-dioxo-1,2-benzothiazol-3-yl)-2-(1,3-dioxoisoindol-2-yl)acetohydrazide (PubChem CID 3271353) has the molecular formula C20H15N5O5S and a molecular weight of 437.44 g/mol. Its IUPAC name is N'-(2-cyanoethyl)-N'-(1,1-dioxo-1,2-benzothiazol-3-yl)-2-(1,3-dioxoisoindol-2-yl)acetohydrazide.
| Compound Name | N'-(2-cyanoethyl)-N'-(1,1-dioxo-1,2-benzothiazol-3-yl)-2-(1,3-dioxoisoindol-2-yl)acetohydrazide |
|---|---|
| PubChem CID | 3271353 |
| Molecular Formula | C20H15N5O5S |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | N'-(2-cyanoethyl)-N'-(1,1-dioxo-1,2-benzothiazol-3-yl)-2-(1,3-dioxoisoindol-2-yl)acetohydrazide |
| SMILES | N#CCCN(NC(=O)CN1C(=O)c2ccccc2C1=O)C1=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C20H15N5O5S/c21-10-5-11-25(18-15-8-3-4-9-16(15)31(29,30)23-18)22-17(26)12-24-19(27)13-6-1-2-7-14(13)20(24)28/h1-4,6-9H,5,11-12H2,(H,22,26) |
| InChIKey | MCISVARBGKLGEV-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 140.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|