C12H16N2O5 — CID 3271792
N-(2,3,4,5-tetrahydroxypentylideneamino)benzamide (PubChem CID 3271792) has the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. Its IUPAC name is N-(2,3,4,5-tetrahydroxypentylideneamino)benzamide.
| Compound Name | N-(2,3,4,5-tetrahydroxypentylideneamino)benzamide |
|---|---|
| PubChem CID | 3271792 |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | N-(2,3,4,5-tetrahydroxypentylideneamino)benzamide |
| SMILES | O=C(NN=CC(O)C(O)C(O)CO)c1ccccc1 |
| InChI | InChI=1S/C12H16N2O5/c15-7-10(17)11(18)9(16)6-13-14-12(19)8-4-2-1-3-5-8/h1-6,9-11,15-18H,7H2,(H,14,19) |
| InChIKey | YDDASHLSULTJAX-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|