About 3-nitrobenzoate
3-nitrobenzoate (PubChem CID 3271820) has the molecular formula C7H4NO4-
and a molecular weight of 166.11 g/mol. Its IUPAC name is 3-nitrobenzoate.
Molecular Properties
| Compound Name | 3-nitrobenzoate |
| PubChem CID | 3271820 |
| Molecular Formula | C7H4NO4- |
| Molecular Weight | 166.11 g/mol |
| Exact Mass | 166.01 |
| IUPAC Name | 3-nitrobenzoate |
| SMILES | O=C([O-])c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H5NO4/c9-7(10)5-2-1-3-6(4-5)8(11)12/h1-4H,(H,9,10)/p-1 |
| InChIKey | AFPHTEQTJZKQAQ-UHFFFAOYSA-M |
| XLogP | -0.04 |
| TPSA | 83.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.11 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitrobenzoate?
The IUPAC name of 3-nitrobenzoate (CID 3271820) is 3-nitrobenzoate.
What is the SMILES notation for 3-nitrobenzoate?
The canonical SMILES for 3-nitrobenzoate is O=C([O-])c1cccc([N+](=O)[O-])c1.
What is the InChIKey of 3-nitrobenzoate?
The InChIKey is AFPHTEQTJZKQAQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H5NO4/c9-7(10)5-2-1-3-6(4-5)8(11)12/h1-4H,(H,9,10)/p-1.
What are the key properties of 3-nitrobenzoate?
3-nitrobenzoate has a molecular weight of 166.11 g/mol, XLogP of -0.04, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitrobenzoate is sourced from PubChem (CID 3271820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).