C20H31N3O2 — CID 32718395
2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-[3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]propyl]acetamide (PubChem CID 32718395) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-[3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]propyl]acetamide.
| Compound Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-[3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]propyl]acetamide |
|---|---|
| PubChem CID | 32718395 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | 2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-[3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]propyl]acetamide |
| SMILES | C[C@@H]1CN(CCCNC(=O)CN2CCc3ccccc3C2)C[C@H](C)O1 |
| InChI | InChI=1S/C20H31N3O2/c1-16-12-22(13-17(2)25-16)10-5-9-21-20(24)15-23-11-8-18-6-3-4-7-19(18)14-23/h3-4,6-7,16-17H,5,8-15H2,1-2H3,(H,21,24)/t16-,17+ |
| InChIKey | MQFCUOQOVNYIGJ-CALCHBBNSA-N |
| XLogP | 1.66 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|