C17H14Br2N2O4S — CID 3271843
3,5-dibromo-2-[[2-(3-methylphenoxy)acetyl]carbamothioylamino]benzoic acid (PubChem CID 3271843) has the molecular formula C17H14Br2N2O4S and a molecular weight of 502.18 g/mol. Its IUPAC name is 3,5-dibromo-2-[[2-(3-methylphenoxy)acetyl]carbamothioylamino]benzoic acid.
| Compound Name | 3,5-dibromo-2-[[2-(3-methylphenoxy)acetyl]carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 3271843 |
| Molecular Formula | C17H14Br2N2O4S |
| Molecular Weight | 502.18 g/mol |
| Exact Mass | 499.90 |
| IUPAC Name | 3,5-dibromo-2-[[2-(3-methylphenoxy)acetyl]carbamothioylamino]benzoic acid |
| SMILES | Cc1cccc(OCC(=O)NC(=S)Nc2c(Br)cc(Br)cc2C(=O)O)c1 |
| InChI | InChI=1S/C17H14Br2N2O4S/c1-9-3-2-4-11(5-9)25-8-14(22)20-17(26)21-15-12(16(23)24)6-10(18)7-13(15)19/h2-7H,8H2,1H3,(H,23,24)(H2,20,21,22,26) |
| InChIKey | XTGWYJVXSOADFE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.18 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|