About 1-hydroxy-2,4,5-trimethylimidazole
1-hydroxy-2,4,5-trimethylimidazole (PubChem CID 3271952) has the molecular formula C6H10N2O
and a molecular weight of 126.16 g/mol. Its IUPAC name is 1-hydroxy-2,4,5-trimethylimidazole.
Molecular Properties
| Compound Name | 1-hydroxy-2,4,5-trimethylimidazole |
| PubChem CID | 3271952 |
| Molecular Formula | C6H10N2O |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.08 |
| IUPAC Name | 1-hydroxy-2,4,5-trimethylimidazole |
| SMILES | Cc1nc(C)n(O)c1C |
| InChI | InChI=1S/C6H10N2O/c1-4-5(2)8(9)6(3)7-4/h9H,1-3H3 |
| InChIKey | ZQKKFZUJLJOLII-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-2,4,5-trimethylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-2,4,5-trimethylimidazole?
The IUPAC name of 1-hydroxy-2,4,5-trimethylimidazole (CID 3271952) is 1-hydroxy-2,4,5-trimethylimidazole.
What is the SMILES notation for 1-hydroxy-2,4,5-trimethylimidazole?
The canonical SMILES for 1-hydroxy-2,4,5-trimethylimidazole is Cc1nc(C)n(O)c1C.
What is the InChIKey of 1-hydroxy-2,4,5-trimethylimidazole?
The InChIKey is ZQKKFZUJLJOLII-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O/c1-4-5(2)8(9)6(3)7-4/h9H,1-3H3.
What are the key properties of 1-hydroxy-2,4,5-trimethylimidazole?
1-hydroxy-2,4,5-trimethylimidazole has a molecular weight of 126.16 g/mol, XLogP of 1.05, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-2,4,5-trimethylimidazole is sourced from PubChem (CID 3271952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).