C17H17NO2 — CID 3272254
1,6-dimethyl-8,9,10,11-tetrahydro-7H-pyrano[2,3-c]carbazol-3-one (PubChem CID 3272254) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is 1,6-dimethyl-8,9,10,11-tetrahydro-7H-pyrano[2,3-c]carbazol-3-one.
| Compound Name | 1,6-dimethyl-8,9,10,11-tetrahydro-7H-pyrano[2,3-c]carbazol-3-one |
|---|---|
| PubChem CID | 3272254 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 1,6-dimethyl-8,9,10,11-tetrahydro-7H-pyrano[2,3-c]carbazol-3-one |
| SMILES | Cc1cc2oc(=O)cc(C)c2c2c3c([nH]c12)CCCC3 |
| InChI | InChI=1S/C17H17NO2/c1-9-8-14(19)20-13-7-10(2)17-16(15(9)13)11-5-3-4-6-12(11)18-17/h7-8,18H,3-6H2,1-2H3 |
| InChIKey | NGEWVIJBCBCZSO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 46.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|