About 2-piperidin-1-ylethyl 1H-indole-3-carboxylate
2-piperidin-1-ylethyl 1H-indole-3-carboxylate (PubChem CID 3272300) has the molecular formula C16H20N2O2
and a molecular weight of 272.35 g/mol. Its IUPAC name is 2-piperidin-1-ylethyl 1H-indole-3-carboxylate.
Molecular Properties
| Compound Name | 2-piperidin-1-ylethyl 1H-indole-3-carboxylate |
| PubChem CID | 3272300 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 2-piperidin-1-ylethyl 1H-indole-3-carboxylate |
| SMILES | O=C(OCCN1CCCCC1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C16H20N2O2/c19-16(20-11-10-18-8-4-1-5-9-18)14-12-17-15-7-3-2-6-13(14)15/h2-3,6-7,12,17H,1,4-5,8-11H2 |
| InChIKey | YGKPIROTKVQCCU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-piperidin-1-ylethyl 1H-indole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-1-ylethyl 1H-indole-3-carboxylate?
The IUPAC name of 2-piperidin-1-ylethyl 1H-indole-3-carboxylate (CID 3272300) is 2-piperidin-1-ylethyl 1H-indole-3-carboxylate.
What is the SMILES notation for 2-piperidin-1-ylethyl 1H-indole-3-carboxylate?
The canonical SMILES for 2-piperidin-1-ylethyl 1H-indole-3-carboxylate is O=C(OCCN1CCCCC1)c1c[nH]c2ccccc12.
What is the InChIKey of 2-piperidin-1-ylethyl 1H-indole-3-carboxylate?
The InChIKey is YGKPIROTKVQCCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O2/c19-16(20-11-10-18-8-4-1-5-9-18)14-12-17-15-7-3-2-6-13(14)15/h2-3,6-7,12,17H,1,4-5,8-11H2.
What are the key properties of 2-piperidin-1-ylethyl 1H-indole-3-carboxylate?
2-piperidin-1-ylethyl 1H-indole-3-carboxylate has a molecular weight of 272.35 g/mol, XLogP of 2.81, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-1-ylethyl 1H-indole-3-carboxylate is sourced from PubChem (CID 3272300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).