C16H21NO — CID 3272708
N-(1-phenylethyl)bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 3272708) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is N-(1-phenylethyl)bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | N-(1-phenylethyl)bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 3272708 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | N-(1-phenylethyl)bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | CC(NC(=O)C1CC2CCC1C2)c1ccccc1 |
| InChI | InChI=1S/C16H21NO/c1-11(13-5-3-2-4-6-13)17-16(18)15-10-12-7-8-14(15)9-12/h2-6,11-12,14-15H,7-10H2,1H3,(H,17,18) |
| InChIKey | RNJBGBKRHBYLJU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |