About 3-[2,4-dichloro-5-(2-methoxyethoxy)phenyl]-1H-imidazole-2-thione
3-[2,4-dichloro-5-(2-methoxyethoxy)phenyl]-1H-imidazole-2-thione (PubChem CID 3273361) has the molecular formula C12H12Cl2N2O2S
and a molecular weight of 319.21 g/mol. Its IUPAC name is 3-[2,4-dichloro-5-(2-methoxyethoxy)phenyl]-1H-imidazole-2-thione.
Molecular Properties
| Compound Name | 3-[2,4-dichloro-5-(2-methoxyethoxy)phenyl]-1H-imidazole-2-thione |
| PubChem CID | 3273361 |
| Molecular Formula | C12H12Cl2N2O2S |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | 3-[2,4-dichloro-5-(2-methoxyethoxy)phenyl]-1H-imidazole-2-thione |
| SMILES | COCCOc1cc(-n2cc[nH]c2=S)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H12Cl2N2O2S/c1-17-4-5-18-11-7-10(8(13)6-9(11)14)16-3-2-15-12(16)19/h2-3,6-7H,4-5H2,1H3,(H,15,19) |
| InChIKey | WICKWDRKKIHHDF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 39.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[2,4-dichloro-5-(2-methoxyethoxy)phenyl]-1H-imidazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,4-dichloro-5-(2-methoxyethoxy)phenyl]-1H-imidazole-2-thione?
The IUPAC name of 3-[2,4-dichloro-5-(2-methoxyethoxy)phenyl]-1H-imidazole-2-thione (CID 3273361) is 3-[2,4-dichloro-5-(2-methoxyethoxy)phenyl]-1H-imidazole-2-thione.
What is the SMILES notation for 3-[2,4-dichloro-5-(2-methoxyethoxy)phenyl]-1H-imidazole-2-thione?
The canonical SMILES for 3-[2,4-dichloro-5-(2-methoxyethoxy)phenyl]-1H-imidazole-2-thione is COCCOc1cc(-n2cc[nH]c2=S)c(Cl)cc1Cl.
What is the InChIKey of 3-[2,4-dichloro-5-(2-methoxyethoxy)phenyl]-1H-imidazole-2-thione?
The InChIKey is WICKWDRKKIHHDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12Cl2N2O2S/c1-17-4-5-18-11-7-10(8(13)6-9(11)14)16-3-2-15-12(16)19/h2-3,6-7H,4-5H2,1H3,(H,15,19).
What are the key properties of 3-[2,4-dichloro-5-(2-methoxyethoxy)phenyl]-1H-imidazole-2-thione?
3-[2,4-dichloro-5-(2-methoxyethoxy)phenyl]-1H-imidazole-2-thione has a molecular weight of 319.21 g/mol, XLogP of 3.87, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,4-dichloro-5-(2-methoxyethoxy)phenyl]-1H-imidazole-2-thione is sourced from PubChem (CID 3273361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).