C30H29N3O2 — CID 32735745
2-[2-(naphthalen-2-yloxymethyl)benzimidazol-1-yl]-N-[(2R)-4-phenylbutan-2-yl]acetamide (PubChem CID 32735745) has the molecular formula C30H29N3O2 and a molecular weight of 463.58 g/mol. Its IUPAC name is 2-[2-(naphthalen-2-yloxymethyl)benzimidazol-1-yl]-N-[(2R)-4-phenylbutan-2-yl]acetamide.
| Compound Name | 2-[2-(naphthalen-2-yloxymethyl)benzimidazol-1-yl]-N-[(2R)-4-phenylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 32735745 |
| Molecular Formula | C30H29N3O2 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | 2-[2-(naphthalen-2-yloxymethyl)benzimidazol-1-yl]-N-[(2R)-4-phenylbutan-2-yl]acetamide |
| SMILES | C[C@H](CCc1ccccc1)NC(=O)Cn1c(COc2ccc3ccccc3c2)nc2ccccc21 |
| InChI | InChI=1S/C30H29N3O2/c1-22(15-16-23-9-3-2-4-10-23)31-30(34)20-33-28-14-8-7-13-27(28)32-29(33)21-35-26-18-17-24-11-5-6-12-25(24)19-26/h2-14,17-19,22H,15-16,20-21H2,1H3,(H,31,34)/t22-/m1/s1 |
| InChIKey | VXWKOOHQGAPFHE-JOCHJYFZSA-N |
| XLogP | 5.91 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |