C16H12N2O3 — CID 3273641
1'-methylspiro[3H-1,3-benzoxazine-2,3'-indole]-2',4-dione (PubChem CID 3273641) has the molecular formula C16H12N2O3 and a molecular weight of 280.28 g/mol. Its IUPAC name is 1'-methylspiro[3H-1,3-benzoxazine-2,3'-indole]-2',4-dione.
| Compound Name | 1'-methylspiro[3H-1,3-benzoxazine-2,3'-indole]-2',4-dione |
|---|---|
| PubChem CID | 3273641 |
| Molecular Formula | C16H12N2O3 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 1'-methylspiro[3H-1,3-benzoxazine-2,3'-indole]-2',4-dione |
| SMILES | CN1C(=O)C2(NC(=O)c3ccccc3O2)c2ccccc21 |
| InChI | InChI=1S/C16H12N2O3/c1-18-12-8-4-3-7-11(12)16(15(18)20)17-14(19)10-6-2-5-9-13(10)21-16/h2-9H,1H3,(H,17,19) |
| InChIKey | OZPNYAHEDUKMPF-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |