C14H22N2O3S — CID 32736543
3-[(3,4-dimethylphenyl)sulfonylamino]-N-propylpropanamide (PubChem CID 32736543) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is 3-[(3,4-dimethylphenyl)sulfonylamino]-N-propylpropanamide.
| Compound Name | 3-[(3,4-dimethylphenyl)sulfonylamino]-N-propylpropanamide |
|---|---|
| PubChem CID | 32736543 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 3-[(3,4-dimethylphenyl)sulfonylamino]-N-propylpropanamide |
| SMILES | CCCNC(=O)CCNS(=O)(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C14H22N2O3S/c1-4-8-15-14(17)7-9-16-20(18,19)13-6-5-11(2)12(3)10-13/h5-6,10,16H,4,7-9H2,1-3H3,(H,15,17) |
| InChIKey | IMNALTTWTGLGNK-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |