C29H29NO5 — CID 3273684
4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-1-(2-methoxyethyl)-5-(4-methylphenyl)pyrrolidine-2,3-dione (PubChem CID 3273684) has the molecular formula C29H29NO5 and a molecular weight of 471.55 g/mol. Its IUPAC name is 4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-1-(2-methoxyethyl)-5-(4-methylphenyl)pyrrolidine-2,3-dione.
| Compound Name | 4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-1-(2-methoxyethyl)-5-(4-methylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 3273684 |
| Molecular Formula | C29H29NO5 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 4-[hydroxy-[4-[(3-methylphenyl)methoxy]phenyl]methylidene]-1-(2-methoxyethyl)-5-(4-methylphenyl)pyrrolidine-2,3-dione |
| SMILES | COCCN1C(=O)C(=O)C(=C(O)c2ccc(OCc3cccc(C)c3)cc2)C1c1ccc(C)cc1 |
| InChI | InChI=1S/C29H29NO5/c1-19-7-9-22(10-8-19)26-25(28(32)29(33)30(26)15-16-34-3)27(31)23-11-13-24(14-12-23)35-18-21-6-4-5-20(2)17-21/h4-14,17,26,31H,15-16,18H2,1-3H3 |
| InChIKey | MEVWADMIUUOXHX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|