C22H30N4O4 — CID 32741538
N-(2-hydroxyphenyl)-1-[(2R)-1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxohexan-2-yl]piperidine-4-carboxamide (PubChem CID 32741538) has the molecular formula C22H30N4O4 and a molecular weight of 414.51 g/mol. Its IUPAC name is N-(2-hydroxyphenyl)-1-[(2R)-1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxohexan-2-yl]piperidine-4-carboxamide.
| Compound Name | N-(2-hydroxyphenyl)-1-[(2R)-1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxohexan-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 32741538 |
| Molecular Formula | C22H30N4O4 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | N-(2-hydroxyphenyl)-1-[(2R)-1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxohexan-2-yl]piperidine-4-carboxamide |
| SMILES | CCCC[C@H](C(=O)Nc1cc(C)on1)N1CCC(C(=O)Nc2ccccc2O)CC1 |
| InChI | InChI=1S/C22H30N4O4/c1-3-4-8-18(22(29)24-20-14-15(2)30-25-20)26-12-10-16(11-13-26)21(28)23-17-7-5-6-9-19(17)27/h5-7,9,14,16,18,27H,3-4,8,10-13H2,1-2H3,(H,23,28)(H,24,25,29)/t18-/m1/s1 |
| InChIKey | RDUQYTFKINYOAU-GOSISDBHSA-N |
| XLogP | 3.54 |
| TPSA | 107.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|