C24H20Br2N4O4 — CID 3274515
1-N',4-N'-bis(3-bromo-4-methylbenzoyl)benzene-1,4-dicarbohydrazide (PubChem CID 3274515) has the molecular formula C24H20Br2N4O4 and a molecular weight of 588.26 g/mol. Its IUPAC name is 1-N',4-N'-bis(3-bromo-4-methylbenzoyl)benzene-1,4-dicarbohydrazide.
| Compound Name | 1-N',4-N'-bis(3-bromo-4-methylbenzoyl)benzene-1,4-dicarbohydrazide |
|---|---|
| PubChem CID | 3274515 |
| Molecular Formula | C24H20Br2N4O4 |
| Molecular Weight | 588.26 g/mol |
| Exact Mass | 585.99 |
| IUPAC Name | 1-N',4-N'-bis(3-bromo-4-methylbenzoyl)benzene-1,4-dicarbohydrazide |
| SMILES | Cc1ccc(C(=O)NNC(=O)c2ccc(C(=O)NNC(=O)c3ccc(C)c(Br)c3)cc2)cc1Br |
| InChI | InChI=1S/C24H20Br2N4O4/c1-13-3-5-17(11-19(13)25)23(33)29-27-21(31)15-7-9-16(10-8-15)22(32)28-30-24(34)18-6-4-14(2)20(26)12-18/h3-12H,1-2H3,(H,27,31)(H,28,32)(H,29,33)(H,30,34) |
| InChIKey | PHMLJFTVOOCYFX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.26 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|