C23H22N2O — CID 3274563
1-hydroxy-5,5-dimethyl-2,2,4-triphenylimidazole (PubChem CID 3274563) has the molecular formula C23H22N2O and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-hydroxy-5,5-dimethyl-2,2,4-triphenylimidazole.
| Compound Name | 1-hydroxy-5,5-dimethyl-2,2,4-triphenylimidazole |
|---|---|
| PubChem CID | 3274563 |
| Molecular Formula | C23H22N2O |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 1-hydroxy-5,5-dimethyl-2,2,4-triphenylimidazole |
| SMILES | CC1(C)C(c2ccccc2)=NC(c2ccccc2)(c2ccccc2)N1O |
| InChI | InChI=1S/C23H22N2O/c1-22(2)21(18-12-6-3-7-13-18)24-23(25(22)26,19-14-8-4-9-15-19)20-16-10-5-11-17-20/h3-17,26H,1-2H3 |
| InChIKey | SCPKKCGCKOCKIP-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |