C20H23N5O2 — CID 3274715
6-imino-7,11-dimethyl-5-(4-methylpiperidine-1-carbonyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-2-one (PubChem CID 3274715) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is 6-imino-7,11-dimethyl-5-(4-methylpiperidine-1-carbonyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-2-one.
| Compound Name | 6-imino-7,11-dimethyl-5-(4-methylpiperidine-1-carbonyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-2-one |
|---|---|
| PubChem CID | 3274715 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 6-imino-7,11-dimethyl-5-(4-methylpiperidine-1-carbonyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-2-one |
| SMILES | [H]/N=c1/c(C(=O)N2CCC(C)CC2)cc2c(=O)n3cccc(C)c3nc2n1C |
| InChI | InChI=1S/C20H23N5O2/c1-12-6-9-24(10-7-12)19(26)14-11-15-18(23(3)16(14)21)22-17-13(2)5-4-8-25(17)20(15)27/h4-5,8,11-12,21H,6-7,9-10H2,1-3H3/b21-16- |
| InChIKey | RPDUNPLPJWDOAT-PGMHBOJBSA-N |
| XLogP | 1.85 |
| TPSA | 83.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|