C18H15BrN2O — CID 3275189
4-(4-bromophenyl)-3,4,5,6-tetrahydro-1H-benzo[h]quinazolin-2-one (PubChem CID 3275189) has the molecular formula C18H15BrN2O and a molecular weight of 355.24 g/mol. Its IUPAC name is 4-(4-bromophenyl)-3,4,5,6-tetrahydro-1H-benzo[h]quinazolin-2-one.
| Compound Name | 4-(4-bromophenyl)-3,4,5,6-tetrahydro-1H-benzo[h]quinazolin-2-one |
|---|---|
| PubChem CID | 3275189 |
| Molecular Formula | C18H15BrN2O |
| Molecular Weight | 355.24 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 4-(4-bromophenyl)-3,4,5,6-tetrahydro-1H-benzo[h]quinazolin-2-one |
| SMILES | O=C1NC2=C(CCc3ccccc32)C(c2ccc(Br)cc2)N1 |
| InChI | InChI=1S/C18H15BrN2O/c19-13-8-5-12(6-9-13)16-15-10-7-11-3-1-2-4-14(11)17(15)21-18(22)20-16/h1-6,8-9,16H,7,10H2,(H2,20,21,22) |
| InChIKey | XTIBAFMYLAETDT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.24 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |