About 6-amino-3-butan-2-yl-4,5-dihydropyrimidin-2-one
6-amino-3-butan-2-yl-4,5-dihydropyrimidin-2-one (PubChem CID 3275309) has the molecular formula C8H15N3O
and a molecular weight of 169.23 g/mol. Its IUPAC name is 6-amino-3-butan-2-yl-4,5-dihydropyrimidin-2-one.
Molecular Properties
| Compound Name | 6-amino-3-butan-2-yl-4,5-dihydropyrimidin-2-one |
| PubChem CID | 3275309 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | 6-amino-3-butan-2-yl-4,5-dihydropyrimidin-2-one |
| SMILES | CCC(C)N1CCC(N)=NC1=O |
| InChI | InChI=1S/C8H15N3O/c1-3-6(2)11-5-4-7(9)10-8(11)12/h6H,3-5H2,1-2H3,(H2,9,10,12) |
| InChIKey | PYZYLWWXHFRBDO-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-amino-3-butan-2-yl-4,5-dihydropyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-3-butan-2-yl-4,5-dihydropyrimidin-2-one?
The IUPAC name of 6-amino-3-butan-2-yl-4,5-dihydropyrimidin-2-one (CID 3275309) is 6-amino-3-butan-2-yl-4,5-dihydropyrimidin-2-one.
What is the SMILES notation for 6-amino-3-butan-2-yl-4,5-dihydropyrimidin-2-one?
The canonical SMILES for 6-amino-3-butan-2-yl-4,5-dihydropyrimidin-2-one is CCC(C)N1CCC(N)=NC1=O.
What is the InChIKey of 6-amino-3-butan-2-yl-4,5-dihydropyrimidin-2-one?
The InChIKey is PYZYLWWXHFRBDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O/c1-3-6(2)11-5-4-7(9)10-8(11)12/h6H,3-5H2,1-2H3,(H2,9,10,12).
What are the key properties of 6-amino-3-butan-2-yl-4,5-dihydropyrimidin-2-one?
6-amino-3-butan-2-yl-4,5-dihydropyrimidin-2-one has a molecular weight of 169.23 g/mol, XLogP of 0.97, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-3-butan-2-yl-4,5-dihydropyrimidin-2-one is sourced from PubChem (CID 3275309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).