C22H40N4O4-2 — CID 3275383
N,N'-bis(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl)butanediamide (PubChem CID 3275383) has the molecular formula C22H40N4O4-2 and a molecular weight of 424.59 g/mol. Its IUPAC name is N,N'-bis(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl)butanediamide.
| Compound Name | N,N'-bis(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl)butanediamide |
|---|---|
| PubChem CID | 3275383 |
| Molecular Formula | C22H40N4O4-2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.31 |
| IUPAC Name | N,N'-bis(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl)butanediamide |
| SMILES | CC1(C)CC(NC(=O)CCC(=O)NC2CC(C)(C)N([O-])C(C)(C)C2)CC(C)(C)N1[O-] |
| InChI | InChI=1S/C22H40N4O4/c1-19(2)11-15(12-20(3,4)25(19)29)23-17(27)9-10-18(28)24-16-13-21(5,6)26(30)22(7,8)14-16/h15-16H,9-14H2,1-8H3,(H,23,27)(H,24,28)/q-2 |
| InChIKey | VDCMCHGWIXSLAN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |