C17H15BrO8 — CID 3275410
ethyl 7-bromo-1,14-dimethyl-3,5,9,11-tetraoxo-4,10-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-13-carboxylate (PubChem CID 3275410) has the molecular formula C17H15BrO8 and a molecular weight of 427.20 g/mol. Its IUPAC name is ethyl 7-bromo-1,14-dimethyl-3,5,9,11-tetraoxo-4,10-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-13-carboxylate.
| Compound Name | ethyl 7-bromo-1,14-dimethyl-3,5,9,11-tetraoxo-4,10-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-13-carboxylate |
|---|---|
| PubChem CID | 3275410 |
| Molecular Formula | C17H15BrO8 |
| Molecular Weight | 427.20 g/mol |
| Exact Mass | 426.00 |
| IUPAC Name | ethyl 7-bromo-1,14-dimethyl-3,5,9,11-tetraoxo-4,10-dioxatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-13-carboxylate |
| SMILES | CCOC(=O)C1=C(C)C2(Br)C3C(=O)OC(=O)C3C1(C)C1C(=O)OC(=O)C12 |
| InChI | InChI=1S/C17H15BrO8/c1-4-24-11(19)6-5(2)17(18)9-7(12(20)25-14(9)22)16(6,3)8-10(17)15(23)26-13(8)21/h7-10H,4H2,1-3H3 |
| InChIKey | QFHRXGLGTTYDSP-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.20 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|