About 1-(4-ethylphenyl)-3,4-dimethylpyrano[3,2-d]pyrazol-6-one
1-(4-ethylphenyl)-3,4-dimethylpyrano[3,2-d]pyrazol-6-one (PubChem CID 3275580) has the molecular formula C16H16N2O2
and a molecular weight of 268.32 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-3,4-dimethylpyrano[3,2-d]pyrazol-6-one.
Molecular Properties
| Compound Name | 1-(4-ethylphenyl)-3,4-dimethylpyrano[3,2-d]pyrazol-6-one |
| PubChem CID | 3275580 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 1-(4-ethylphenyl)-3,4-dimethylpyrano[3,2-d]pyrazol-6-one |
| SMILES | CCc1ccc(-n2nc(C)c3c(C)cc(=O)oc32)cc1 |
| InChI | InChI=1S/C16H16N2O2/c1-4-12-5-7-13(8-6-12)18-16-15(11(3)17-18)10(2)9-14(19)20-16/h5-9H,4H2,1-3H3 |
| InChIKey | ZIGKXUBWBQZSNQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-ethylphenyl)-3,4-dimethylpyrano[3,2-d]pyrazol-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-ethylphenyl)-3,4-dimethylpyrano[3,2-d]pyrazol-6-one?
The IUPAC name of 1-(4-ethylphenyl)-3,4-dimethylpyrano[3,2-d]pyrazol-6-one (CID 3275580) is 1-(4-ethylphenyl)-3,4-dimethylpyrano[3,2-d]pyrazol-6-one.
What is the SMILES notation for 1-(4-ethylphenyl)-3,4-dimethylpyrano[3,2-d]pyrazol-6-one?
The canonical SMILES for 1-(4-ethylphenyl)-3,4-dimethylpyrano[3,2-d]pyrazol-6-one is CCc1ccc(-n2nc(C)c3c(C)cc(=O)oc32)cc1.
What is the InChIKey of 1-(4-ethylphenyl)-3,4-dimethylpyrano[3,2-d]pyrazol-6-one?
The InChIKey is ZIGKXUBWBQZSNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O2/c1-4-12-5-7-13(8-6-12)18-16-15(11(3)17-18)10(2)9-14(19)20-16/h5-9H,4H2,1-3H3.
What are the key properties of 1-(4-ethylphenyl)-3,4-dimethylpyrano[3,2-d]pyrazol-6-one?
1-(4-ethylphenyl)-3,4-dimethylpyrano[3,2-d]pyrazol-6-one has a molecular weight of 268.32 g/mol, XLogP of 3.16, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-ethylphenyl)-3,4-dimethylpyrano[3,2-d]pyrazol-6-one is sourced from PubChem (CID 3275580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).