C20H17BrN2O2S — CID 32758172
N-[3-[(4-bromophenyl)methyl-methylcarbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 32758172) has the molecular formula C20H17BrN2O2S and a molecular weight of 429.34 g/mol. Its IUPAC name is N-[3-[(4-bromophenyl)methyl-methylcarbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[(4-bromophenyl)methyl-methylcarbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 32758172 |
| Molecular Formula | C20H17BrN2O2S |
| Molecular Weight | 429.34 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | N-[3-[(4-bromophenyl)methyl-methylcarbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | CN(Cc1ccc(Br)cc1)C(=O)c1cccc(NC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C20H17BrN2O2S/c1-23(13-14-7-9-16(21)10-8-14)20(25)15-4-2-5-17(12-15)22-19(24)18-6-3-11-26-18/h2-12H,13H2,1H3,(H,22,24) |
| InChIKey | XTNLXVUMHSBWON-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.34 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |