C22H34N4O3 — CID 3276636
2-[butan-2-yl(butylcarbamoyl)amino]-N-(furan-2-ylmethyl)-N-[(1-methylpyrrol-2-yl)methyl]acetamide (PubChem CID 3276636) has the molecular formula C22H34N4O3 and a molecular weight of 402.54 g/mol. Its IUPAC name is 2-[butan-2-yl(butylcarbamoyl)amino]-N-(furan-2-ylmethyl)-N-[(1-methylpyrrol-2-yl)methyl]acetamide.
| Compound Name | 2-[butan-2-yl(butylcarbamoyl)amino]-N-(furan-2-ylmethyl)-N-[(1-methylpyrrol-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 3276636 |
| Molecular Formula | C22H34N4O3 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | 2-[butan-2-yl(butylcarbamoyl)amino]-N-(furan-2-ylmethyl)-N-[(1-methylpyrrol-2-yl)methyl]acetamide |
| SMILES | CCCCNC(=O)N(CC(=O)N(Cc1ccco1)Cc1cccn1C)C(C)CC |
| InChI | InChI=1S/C22H34N4O3/c1-5-7-12-23-22(28)26(18(3)6-2)17-21(27)25(16-20-11-9-14-29-20)15-19-10-8-13-24(19)4/h8-11,13-14,18H,5-7,12,15-17H2,1-4H3,(H,23,28) |
| InChIKey | RSIBEEMJYXFITA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|