C14H14BrFN2O3S2 — CID 32777538
(2S)-N-[(5-bromothiophen-2-yl)methyl]-2-[(2-fluorophenyl)sulfonylamino]propanamide (PubChem CID 32777538) has the molecular formula C14H14BrFN2O3S2 and a molecular weight of 421.31 g/mol. Its IUPAC name is (2S)-N-[(5-bromothiophen-2-yl)methyl]-2-[(2-fluorophenyl)sulfonylamino]propanamide.
| Compound Name | (2S)-N-[(5-bromothiophen-2-yl)methyl]-2-[(2-fluorophenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 32777538 |
| Molecular Formula | C14H14BrFN2O3S2 |
| Molecular Weight | 421.31 g/mol |
| Exact Mass | 419.96 |
| IUPAC Name | (2S)-N-[(5-bromothiophen-2-yl)methyl]-2-[(2-fluorophenyl)sulfonylamino]propanamide |
| SMILES | C[C@H](NS(=O)(=O)c1ccccc1F)C(=O)NCc1ccc(Br)s1 |
| InChI | InChI=1S/C14H14BrFN2O3S2/c1-9(14(19)17-8-10-6-7-13(15)22-10)18-23(20,21)12-5-3-2-4-11(12)16/h2-7,9,18H,8H2,1H3,(H,17,19)/t9-/m0/s1 |
| InChIKey | AQMFOXKEIYMQQV-VIFPVBQESA-N |
| XLogP | 2.63 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |