C28H21N5O2 — CID 3278303
4-(4-nitrophenyl)-1,3-diphenyl-5,10-dihydro-4H-pyrazolo[4,5-c][1,5]benzodiazepine (PubChem CID 3278303) has the molecular formula C28H21N5O2 and a molecular weight of 459.51 g/mol. Its IUPAC name is 4-(4-nitrophenyl)-1,3-diphenyl-5,10-dihydro-4H-pyrazolo[4,5-c][1,5]benzodiazepine.
| Compound Name | 4-(4-nitrophenyl)-1,3-diphenyl-5,10-dihydro-4H-pyrazolo[4,5-c][1,5]benzodiazepine |
|---|---|
| PubChem CID | 3278303 |
| Molecular Formula | C28H21N5O2 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 4-(4-nitrophenyl)-1,3-diphenyl-5,10-dihydro-4H-pyrazolo[4,5-c][1,5]benzodiazepine |
| SMILES | O=[N+]([O-])c1ccc(C2Nc3ccccc3Nc3c2c(-c2ccccc2)nn3-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H21N5O2/c34-33(35)22-17-15-20(16-18-22)26-25-27(19-9-3-1-4-10-19)31-32(21-11-5-2-6-12-21)28(25)30-24-14-8-7-13-23(24)29-26/h1-18,26,29-30H |
| InChIKey | UWNZUKIHHDZWCO-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|