C27H23N3O4 — CID 3281697
3-[[12-(2-methylpiperidin-1-yl)-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]benzoic acid (PubChem CID 3281697) has the molecular formula C27H23N3O4 and a molecular weight of 453.50 g/mol. Its IUPAC name is 3-[[12-(2-methylpiperidin-1-yl)-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]benzoic acid.
| Compound Name | 3-[[12-(2-methylpiperidin-1-yl)-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 3281697 |
| Molecular Formula | C27H23N3O4 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 3-[[12-(2-methylpiperidin-1-yl)-8-oxo-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-10-yl]amino]benzoic acid |
| SMILES | CC1CCCCN1c1cc(Nc2cccc(C(=O)O)c2)c2c3c(onc13)-c1ccccc1C2=O |
| InChI | InChI=1S/C27H23N3O4/c1-15-7-4-5-12-30(15)21-14-20(28-17-9-6-8-16(13-17)27(32)33)22-23-24(21)29-34-26(23)19-11-3-2-10-18(19)25(22)31/h2-3,6,8-11,13-15,28H,4-5,7,12H2,1H3,(H,32,33) |
| InChIKey | FCGAQHSMQNWTOD-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 95.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'quinone_B(5)', 'substructure': 'N/A'} |
|---|