C28H26ClNO3 — CID 3282031
3-benzyl-6-chloro-4-methyl-9-(2,4,6-trimethylphenyl)-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one (PubChem CID 3282031) has the molecular formula C28H26ClNO3 and a molecular weight of 459.97 g/mol. Its IUPAC name is 3-benzyl-6-chloro-4-methyl-9-(2,4,6-trimethylphenyl)-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one.
| Compound Name | 3-benzyl-6-chloro-4-methyl-9-(2,4,6-trimethylphenyl)-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one |
|---|---|
| PubChem CID | 3282031 |
| Molecular Formula | C28H26ClNO3 |
| Molecular Weight | 459.97 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 3-benzyl-6-chloro-4-methyl-9-(2,4,6-trimethylphenyl)-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one |
| SMILES | Cc1cc(C)c(N2COc3c(Cl)cc4c(C)c(Cc5ccccc5)c(=O)oc4c3C2)c(C)c1 |
| InChI | InChI=1S/C28H26ClNO3/c1-16-10-17(2)25(18(3)11-16)30-14-23-26-21(13-24(29)27(23)32-15-30)19(4)22(28(31)33-26)12-20-8-6-5-7-9-20/h5-11,13H,12,14-15H2,1-4H3 |
| InChIKey | AZDZOZHWNJKALP-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.97 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|