About l-Isoleucine, N-trifluoroacetyl-
l-Isoleucine, N-trifluoroacetyl- (PubChem CID 328217) has the molecular formula C8H12F3NO3
and a molecular weight of 227.18 g/mol. Its IUPAC name is 3-methyl-2-[(2,2,2-trifluoroacetyl)amino]pentanoic acid.
Molecular Properties
| Compound Name | l-Isoleucine, N-trifluoroacetyl- |
| PubChem CID | 328217 |
| Molecular Formula | C8H12F3NO3 |
| Molecular Weight | 227.18 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 3-methyl-2-[(2,2,2-trifluoroacetyl)amino]pentanoic acid |
| SMILES | CCC(C)C(C(=O)O)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C8H12F3NO3/c1-3-4(2)5(6(13)14)12-7(15)8(9,10)11/h4-5H,3H2,1-2H3,(H,12,15)(H,13,14) |
| InChIKey | XPCLFBDSELYLIK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | 252 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.18 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze l-Isoleucine, N-trifluoroacetyl- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of l-Isoleucine, N-trifluoroacetyl-?
The IUPAC name of l-Isoleucine, N-trifluoroacetyl- (CID 328217) is 3-methyl-2-[(2,2,2-trifluoroacetyl)amino]pentanoic acid.
What is the SMILES notation for l-Isoleucine, N-trifluoroacetyl-?
The canonical SMILES for l-Isoleucine, N-trifluoroacetyl- is CCC(C)C(C(=O)O)NC(=O)C(F)(F)F.
What is the InChIKey of l-Isoleucine, N-trifluoroacetyl-?
The InChIKey is XPCLFBDSELYLIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F3NO3/c1-3-4(2)5(6(13)14)12-7(15)8(9,10)11/h4-5H,3H2,1-2H3,(H,12,15)(H,13,14).
What are the key properties of l-Isoleucine, N-trifluoroacetyl-?
l-Isoleucine, N-trifluoroacetyl- has a molecular weight of 227.18 g/mol, XLogP of 1.30, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for l-Isoleucine, N-trifluoroacetyl- is sourced from PubChem (CID 328217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).