C26H19ClN2O7 — CID 3282251
ethyl 4-[3-[(4-chlorophenyl)-hydroxymethylidene]-2-(4-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 3282251) has the molecular formula C26H19ClN2O7 and a molecular weight of 506.90 g/mol. Its IUPAC name is ethyl 4-[3-[(4-chlorophenyl)-hydroxymethylidene]-2-(4-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 4-[3-[(4-chlorophenyl)-hydroxymethylidene]-2-(4-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 3282251 |
| Molecular Formula | C26H19ClN2O7 |
| Molecular Weight | 506.90 g/mol |
| Exact Mass | 506.09 |
| IUPAC Name | ethyl 4-[3-[(4-chlorophenyl)-hydroxymethylidene]-2-(4-nitrophenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C(=O)C(=C(O)c3ccc(Cl)cc3)C2c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C26H19ClN2O7/c1-2-36-26(33)17-7-11-19(12-8-17)28-22(15-5-13-20(14-6-15)29(34)35)21(24(31)25(28)32)23(30)16-3-9-18(27)10-4-16/h3-14,22,30H,2H2,1H3 |
| InChIKey | ZJLSAINQNGEGIU-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.90 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|