C20H23NO3 — CID 32822941
[(2R)-2-benzylpyrrolidin-1-yl]-(3,4-dimethoxyphenyl)methanone (PubChem CID 32822941) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is [(2R)-2-benzylpyrrolidin-1-yl]-(3,4-dimethoxyphenyl)methanone.
| Compound Name | [(2R)-2-benzylpyrrolidin-1-yl]-(3,4-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 32822941 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | [(2R)-2-benzylpyrrolidin-1-yl]-(3,4-dimethoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)N2CCC[C@@H]2Cc2ccccc2)cc1OC |
| InChI | InChI=1S/C20H23NO3/c1-23-18-11-10-16(14-19(18)24-2)20(22)21-12-6-9-17(21)13-15-7-4-3-5-8-15/h3-5,7-8,10-11,14,17H,6,9,12-13H2,1-2H3/t17-/m1/s1 |
| InChIKey | AMEXWSRBDFPPFA-QGZVFWFLSA-N |
| XLogP | 3.55 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |