C22H26N2O4 — CID 32824583
1-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]-2-(4-methylphenyl)ethanone (PubChem CID 32824583) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 1-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]-2-(4-methylphenyl)ethanone.
| Compound Name | 1-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]-2-(4-methylphenyl)ethanone |
|---|---|
| PubChem CID | 32824583 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 1-[4-(3,5-dimethoxybenzoyl)piperazin-1-yl]-2-(4-methylphenyl)ethanone |
| SMILES | COc1cc(OC)cc(C(=O)N2CCN(C(=O)Cc3ccc(C)cc3)CC2)c1 |
| InChI | InChI=1S/C22H26N2O4/c1-16-4-6-17(7-5-16)12-21(25)23-8-10-24(11-9-23)22(26)18-13-19(27-2)15-20(14-18)28-3/h4-7,13-15H,8-12H2,1-3H3 |
| InChIKey | ZZLVRSGXZWOVTR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |