C25H27N5O3S — CID 32826304
N-[(S)-(2-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-3-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)propanamide (PubChem CID 32826304) has the molecular formula C25H27N5O3S and a molecular weight of 477.59 g/mol. Its IUPAC name is N-[(S)-(2-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-3-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)propanamide.
| Compound Name | N-[(S)-(2-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-3-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)propanamide |
|---|---|
| PubChem CID | 32826304 |
| Molecular Formula | C25H27N5O3S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | N-[(S)-(2-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-3-(4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)propanamide |
| SMILES | COc1ccccc1[C@H](NC(=O)CCn1cnc2sc3c(c2c1=O)CCCC3)c1nccn1C |
| InChI | InChI=1S/C25H27N5O3S/c1-29-14-12-26-23(29)22(16-7-3-5-9-18(16)33-2)28-20(31)11-13-30-15-27-24-21(25(30)32)17-8-4-6-10-19(17)34-24/h3,5,7,9,12,14-15,22H,4,6,8,10-11,13H2,1-2H3,(H,28,31)/t22-/m0/s1 |
| InChIKey | GBEGTFRBJFHAFX-QFIPXVFZSA-N |
| XLogP | 3.37 |
| TPSA | 91.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |