C22H18ClN3O2S — CID 32827088
N-[(5-chlorothiophen-2-yl)methyl]-3-(2-methoxyphenyl)-1-phenylpyrazole-4-carboxamide (PubChem CID 32827088) has the molecular formula C22H18ClN3O2S and a molecular weight of 423.93 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-3-(2-methoxyphenyl)-1-phenylpyrazole-4-carboxamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-3-(2-methoxyphenyl)-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 32827088 |
| Molecular Formula | C22H18ClN3O2S |
| Molecular Weight | 423.93 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-3-(2-methoxyphenyl)-1-phenylpyrazole-4-carboxamide |
| SMILES | COc1ccccc1-c1nn(-c2ccccc2)cc1C(=O)NCc1ccc(Cl)s1 |
| InChI | InChI=1S/C22H18ClN3O2S/c1-28-19-10-6-5-9-17(19)21-18(14-26(25-21)15-7-3-2-4-8-15)22(27)24-13-16-11-12-20(23)29-16/h2-12,14H,13H2,1H3,(H,24,27) |
| InChIKey | MRKLIAOYUBQJSN-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.93 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |