C25H26ClN3O2S — CID 32827422
2-[4-[[2-(8-chloronaphthalen-1-yl)sulfanylacetyl]amino]piperidin-1-yl]-N-phenylacetamide (PubChem CID 32827422) has the molecular formula C25H26ClN3O2S and a molecular weight of 468.02 g/mol. Its IUPAC name is 2-[4-[[2-(8-chloronaphthalen-1-yl)sulfanylacetyl]amino]piperidin-1-yl]-N-phenylacetamide.
| Compound Name | 2-[4-[[2-(8-chloronaphthalen-1-yl)sulfanylacetyl]amino]piperidin-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 32827422 |
| Molecular Formula | C25H26ClN3O2S |
| Molecular Weight | 468.02 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | 2-[4-[[2-(8-chloronaphthalen-1-yl)sulfanylacetyl]amino]piperidin-1-yl]-N-phenylacetamide |
| SMILES | O=C(CN1CCC(NC(=O)CSc2cccc3cccc(Cl)c23)CC1)Nc1ccccc1 |
| InChI | InChI=1S/C25H26ClN3O2S/c26-21-10-4-6-18-7-5-11-22(25(18)21)32-17-24(31)28-20-12-14-29(15-13-20)16-23(30)27-19-8-2-1-3-9-19/h1-11,20H,12-17H2,(H,27,30)(H,28,31) |
| InChIKey | XALMCTDMTLVAHU-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.02 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |