C21H28N4O4 — CID 32828141
N-(1-adamantyl)-2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetamide (PubChem CID 32828141) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is N-(1-adamantyl)-2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetamide.
| Compound Name | N-(1-adamantyl)-2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetamide |
|---|---|
| PubChem CID | 32828141 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | N-(1-adamantyl)-2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]acetamide |
| SMILES | C=CCn1c(=O)n(CC=C)c(=O)n(CC(=O)NC23CC4CC(CC(C4)C2)C3)c1=O |
| InChI | InChI=1S/C21H28N4O4/c1-3-5-23-18(27)24(6-4-2)20(29)25(19(23)28)13-17(26)22-21-10-14-7-15(11-21)9-16(8-14)12-21/h3-4,14-16H,1-2,5-13H2,(H,22,26) |
| InChIKey | LIKGIANUEUZJRT-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 95.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|