C21H24N6O — CID 32831551
(2S)-1-(4-benzylpiperazin-1-yl)-3-phenyl-2-(tetrazol-1-yl)propan-1-one (PubChem CID 32831551) has the molecular formula C21H24N6O and a molecular weight of 376.46 g/mol. Its IUPAC name is (2S)-1-(4-benzylpiperazin-1-yl)-3-phenyl-2-(tetrazol-1-yl)propan-1-one.
| Compound Name | (2S)-1-(4-benzylpiperazin-1-yl)-3-phenyl-2-(tetrazol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 32831551 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | (2S)-1-(4-benzylpiperazin-1-yl)-3-phenyl-2-(tetrazol-1-yl)propan-1-one |
| SMILES | O=C([C@H](Cc1ccccc1)n1cnnn1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H24N6O/c28-21(20(27-17-22-23-24-27)15-18-7-3-1-4-8-18)26-13-11-25(12-14-26)16-19-9-5-2-6-10-19/h1-10,17,20H,11-16H2/t20-/m0/s1 |
| InChIKey | HJGMUVQMBJFJEU-FQEVSTJZSA-N |
| XLogP | 1.80 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |