C20H27ClN6O+2 — CID 3283337
4-chloro-2-ethyl-N-[1-(2-piperidin-1-ium-1-ylethyl)benzimidazol-2-yl]-1H-pyrazol-2-ium-5-carboxamide (PubChem CID 3283337) has the molecular formula C20H27ClN6O+2 and a molecular weight of 402.93 g/mol. Its IUPAC name is 4-chloro-2-ethyl-N-[1-(2-piperidin-1-ium-1-ylethyl)benzimidazol-2-yl]-1H-pyrazol-2-ium-5-carboxamide.
| Compound Name | 4-chloro-2-ethyl-N-[1-(2-piperidin-1-ium-1-ylethyl)benzimidazol-2-yl]-1H-pyrazol-2-ium-5-carboxamide |
|---|---|
| PubChem CID | 3283337 |
| Molecular Formula | C20H27ClN6O+2 |
| Molecular Weight | 402.93 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 4-chloro-2-ethyl-N-[1-(2-piperidin-1-ium-1-ylethyl)benzimidazol-2-yl]-1H-pyrazol-2-ium-5-carboxamide |
| SMILES | CC[n+]1cc(Cl)c(C(=O)Nc2nc3ccccc3n2CC[NH+]2CCCCC2)[nH]1 |
| InChI | InChI=1S/C20H25ClN6O/c1-2-26-14-15(21)18(24-26)19(28)23-20-22-16-8-4-5-9-17(16)27(20)13-12-25-10-6-3-7-11-25/h4-5,8-9,14H,2-3,6-7,10-13H2,1H3,(H,22,23,28)/p+2 |
| InChIKey | TTYAFCWZMOLMPW-UHFFFAOYSA-P |
| XLogP | 1.65 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.93 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|