C44H35N5O7 — CID 3283708
5-[3-(benzotriazol-1-yl)prop-1-ynyl]-6'-[4-(2-hydroxyethoxy)phenyl]-1',2-dioxo-3',4'-diphenylspiro[1H-indole-3,7'-4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine]-8'-carboxylic acid (PubChem CID 3283708) has the molecular formula C44H35N5O7 and a molecular weight of 745.79 g/mol. Its IUPAC name is 5-[3-(benzotriazol-1-yl)prop-1-ynyl]-6'-[4-(2-hydroxyethoxy)phenyl]-1',2-dioxo-3',4'-diphenylspiro[1H-indole-3,7'-4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine]-8'-carboxylic acid.
| Compound Name | 5-[3-(benzotriazol-1-yl)prop-1-ynyl]-6'-[4-(2-hydroxyethoxy)phenyl]-1',2-dioxo-3',4'-diphenylspiro[1H-indole-3,7'-4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine]-8'-carboxylic acid |
|---|---|
| PubChem CID | 3283708 |
| Molecular Formula | C44H35N5O7 |
| Molecular Weight | 745.79 g/mol |
| Exact Mass | 745.25 |
| IUPAC Name | 5-[3-(benzotriazol-1-yl)prop-1-ynyl]-6'-[4-(2-hydroxyethoxy)phenyl]-1',2-dioxo-3',4'-diphenylspiro[1H-indole-3,7'-4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine]-8'-carboxylic acid |
| SMILES | O=C1OC(c2ccccc2)C(c2ccccc2)N2C1C(C(=O)O)C1(C(=O)Nc3ccc(C#CCn4nnc5ccccc54)cc31)C2c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C44H35N5O7/c50-24-25-55-31-20-18-30(19-21-31)40-44(32-26-27(17-22-33(32)45-43(44)54)10-9-23-48-35-16-8-7-15-34(35)46-47-48)36(41(51)52)38-42(53)56-39(29-13-5-2-6-14-29)37(49(38)40)28-11-3-1-4-12-28/h1-8,11-22,26,36-40,50H,23-25H2,(H,45,54)(H,51,52) |
| InChIKey | BZOWYFMWQDQFFJ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 156.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.79 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|