C44H42N2O8 — CID 3283711
5-[2-(1-hydroxycycloheptyl)ethynyl]-6'-[3-(2-hydroxyethoxy)phenyl]-1',2-dioxo-3',4'-diphenylspiro[1H-indole-3,7'-4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine]-8'-carboxylic acid (PubChem CID 3283711) has the molecular formula C44H42N2O8 and a molecular weight of 726.83 g/mol. Its IUPAC name is 5-[2-(1-hydroxycycloheptyl)ethynyl]-6'-[3-(2-hydroxyethoxy)phenyl]-1',2-dioxo-3',4'-diphenylspiro[1H-indole-3,7'-4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine]-8'-carboxylic acid.
| Compound Name | 5-[2-(1-hydroxycycloheptyl)ethynyl]-6'-[3-(2-hydroxyethoxy)phenyl]-1',2-dioxo-3',4'-diphenylspiro[1H-indole-3,7'-4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine]-8'-carboxylic acid |
|---|---|
| PubChem CID | 3283711 |
| Molecular Formula | C44H42N2O8 |
| Molecular Weight | 726.83 g/mol |
| Exact Mass | 726.29 |
| IUPAC Name | 5-[2-(1-hydroxycycloheptyl)ethynyl]-6'-[3-(2-hydroxyethoxy)phenyl]-1',2-dioxo-3',4'-diphenylspiro[1H-indole-3,7'-4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine]-8'-carboxylic acid |
| SMILES | O=C1OC(c2ccccc2)C(c2ccccc2)N2C1C(C(=O)O)C1(C(=O)Nc3ccc(C#CC4(O)CCCCCC4)cc31)C2c1cccc(OCCO)c1 |
| InChI | InChI=1S/C44H42N2O8/c47-24-25-53-32-17-11-16-31(27-32)39-44(33-26-28(18-19-34(33)45-42(44)51)20-23-43(52)21-9-1-2-10-22-43)35(40(48)49)37-41(50)54-38(30-14-7-4-8-15-30)36(46(37)39)29-12-5-3-6-13-29/h3-8,11-19,26-27,35-39,47,52H,1-2,9-10,21-22,24-25H2,(H,45,51)(H,48,49) |
| InChIKey | WETCTEUDUCYIFH-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 145.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.83 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|