About 3-benzylmorpholine
3-benzylmorpholine (PubChem CID 3283983) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is 3-benzylmorpholine.
Molecular Properties
| Compound Name | 3-benzylmorpholine |
| PubChem CID | 3283983 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 3-benzylmorpholine |
| SMILES | c1ccc(CC2COCCN2)cc1 |
| InChI | InChI=1S/C11H15NO/c1-2-4-10(5-3-1)8-11-9-13-7-6-12-11/h1-5,11-12H,6-9H2 |
| InChIKey | LSXCLMMIDIVSFG-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-benzylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzylmorpholine?
The IUPAC name of 3-benzylmorpholine (CID 3283983) is 3-benzylmorpholine.
What is the SMILES notation for 3-benzylmorpholine?
The canonical SMILES for 3-benzylmorpholine is c1ccc(CC2COCCN2)cc1.
What is the InChIKey of 3-benzylmorpholine?
The InChIKey is LSXCLMMIDIVSFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO/c1-2-4-10(5-3-1)8-11-9-13-7-6-12-11/h1-5,11-12H,6-9H2.
What are the key properties of 3-benzylmorpholine?
3-benzylmorpholine has a molecular weight of 177.25 g/mol, XLogP of 1.22, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzylmorpholine is sourced from PubChem (CID 3283983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).