About 1-(4-methoxyphenyl)-2,4,6-triphenylpyridin-1-ium
1-(4-methoxyphenyl)-2,4,6-triphenylpyridin-1-ium (PubChem CID 3284093) has the molecular formula C30H24NO+
and a molecular weight of 414.53 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2,4,6-triphenylpyridin-1-ium.
Molecular Properties
| Compound Name | 1-(4-methoxyphenyl)-2,4,6-triphenylpyridin-1-ium |
| PubChem CID | 3284093 |
| Molecular Formula | C30H24NO+ |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 1-(4-methoxyphenyl)-2,4,6-triphenylpyridin-1-ium |
| SMILES | COc1ccc(-[n+]2c(-c3ccccc3)cc(-c3ccccc3)cc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C30H24NO/c1-32-28-19-17-27(18-20-28)31-29(24-13-7-3-8-14-24)21-26(23-11-5-2-6-12-23)22-30(31)25-15-9-4-10-16-25/h2-22H,1H3/q+1 |
| InChIKey | KCMOVBPDRGDKSU-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-methoxyphenyl)-2,4,6-triphenylpyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methoxyphenyl)-2,4,6-triphenylpyridin-1-ium?
The IUPAC name of 1-(4-methoxyphenyl)-2,4,6-triphenylpyridin-1-ium (CID 3284093) is 1-(4-methoxyphenyl)-2,4,6-triphenylpyridin-1-ium.
What is the SMILES notation for 1-(4-methoxyphenyl)-2,4,6-triphenylpyridin-1-ium?
The canonical SMILES for 1-(4-methoxyphenyl)-2,4,6-triphenylpyridin-1-ium is COc1ccc(-[n+]2c(-c3ccccc3)cc(-c3ccccc3)cc2-c2ccccc2)cc1.
What is the InChIKey of 1-(4-methoxyphenyl)-2,4,6-triphenylpyridin-1-ium?
The InChIKey is KCMOVBPDRGDKSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H24NO/c1-32-28-19-17-27(18-20-28)31-29(24-13-7-3-8-14-24)21-26(23-11-5-2-6-12-23)22-30(31)25-15-9-4-10-16-25/h2-22H,1H3/q+1.
What are the key properties of 1-(4-methoxyphenyl)-2,4,6-triphenylpyridin-1-ium?
1-(4-methoxyphenyl)-2,4,6-triphenylpyridin-1-ium has a molecular weight of 414.53 g/mol, XLogP of 6.97, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methoxyphenyl)-2,4,6-triphenylpyridin-1-ium is sourced from PubChem (CID 3284093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).