About 6-methoxy-3-phenyl-1,2-benzoxazole
6-methoxy-3-phenyl-1,2-benzoxazole (PubChem CID 3286009) has the molecular formula C14H11NO2
and a molecular weight of 225.25 g/mol. Its IUPAC name is 6-methoxy-3-phenyl-1,2-benzoxazole.
Molecular Properties
| Compound Name | 6-methoxy-3-phenyl-1,2-benzoxazole |
| PubChem CID | 3286009 |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 6-methoxy-3-phenyl-1,2-benzoxazole |
| SMILES | COc1ccc2c(-c3ccccc3)noc2c1 |
| InChI | InChI=1S/C14H11NO2/c1-16-11-7-8-12-13(9-11)17-15-14(12)10-5-3-2-4-6-10/h2-9H,1H3 |
| InChIKey | CGBALCVLSJLKAB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methoxy-3-phenyl-1,2-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-3-phenyl-1,2-benzoxazole?
The IUPAC name of 6-methoxy-3-phenyl-1,2-benzoxazole (CID 3286009) is 6-methoxy-3-phenyl-1,2-benzoxazole.
What is the SMILES notation for 6-methoxy-3-phenyl-1,2-benzoxazole?
The canonical SMILES for 6-methoxy-3-phenyl-1,2-benzoxazole is COc1ccc2c(-c3ccccc3)noc2c1.
What is the InChIKey of 6-methoxy-3-phenyl-1,2-benzoxazole?
The InChIKey is CGBALCVLSJLKAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO2/c1-16-11-7-8-12-13(9-11)17-15-14(12)10-5-3-2-4-6-10/h2-9H,1H3.
What are the key properties of 6-methoxy-3-phenyl-1,2-benzoxazole?
6-methoxy-3-phenyl-1,2-benzoxazole has a molecular weight of 225.25 g/mol, XLogP of 3.50, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-3-phenyl-1,2-benzoxazole is sourced from PubChem (CID 3286009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).