C20H18F11NO3S — CID 3286117
propan-2-yl 6-methyl-2-[(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexanecarbonyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 3286117) has the molecular formula C20H18F11NO3S and a molecular weight of 561.41 g/mol. Its IUPAC name is propan-2-yl 6-methyl-2-[(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexanecarbonyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | propan-2-yl 6-methyl-2-[(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexanecarbonyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 3286117 |
| Molecular Formula | C20H18F11NO3S |
| Molecular Weight | 561.41 g/mol |
| Exact Mass | 561.08 |
| IUPAC Name | propan-2-yl 6-methyl-2-[(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexanecarbonyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CC1CCc2c(sc(NC(=O)C3(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C3(F)F)c2C(=O)OC(C)C)C1 |
| InChI | InChI=1S/C20H18F11NO3S/c1-7(2)35-13(33)11-9-5-4-8(3)6-10(9)36-12(11)32-14(34)15(21)16(22,23)18(26,27)20(30,31)19(28,29)17(15,24)25/h7-8H,4-6H2,1-3H3,(H,32,34) |
| InChIKey | QJDHJICTMLOWNY-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.41 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|