About methyl morpholine-3-carboxylate
methyl morpholine-3-carboxylate (PubChem CID 3286806) has the molecular formula C6H11NO3
and a molecular weight of 145.16 g/mol. Its IUPAC name is methyl morpholine-3-carboxylate.
Molecular Properties
| Compound Name | methyl morpholine-3-carboxylate |
| PubChem CID | 3286806 |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | methyl morpholine-3-carboxylate |
| SMILES | COC(=O)C1COCCN1 |
| InChI | InChI=1S/C6H11NO3/c1-9-6(8)5-4-10-3-2-7-5/h5,7H,2-4H2,1H3 |
| InChIKey | VVYXIRKYWOEDRA-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl morpholine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl morpholine-3-carboxylate?
The IUPAC name of methyl morpholine-3-carboxylate (CID 3286806) is methyl morpholine-3-carboxylate.
What is the SMILES notation for methyl morpholine-3-carboxylate?
The canonical SMILES for methyl morpholine-3-carboxylate is COC(=O)C1COCCN1.
What is the InChIKey of methyl morpholine-3-carboxylate?
The InChIKey is VVYXIRKYWOEDRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO3/c1-9-6(8)5-4-10-3-2-7-5/h5,7H,2-4H2,1H3.
What are the key properties of methyl morpholine-3-carboxylate?
methyl morpholine-3-carboxylate has a molecular weight of 145.16 g/mol, XLogP of -0.85, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl morpholine-3-carboxylate is sourced from PubChem (CID 3286806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).